C23H21NO4 — CID 147061913
methyl 12,12-dimethyl-17-oxo-18-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),3,5,7,9,13,15-heptaene-16-carboxylate (PubChem CID 147061913) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is methyl 12,12-dimethyl-17-oxo-18-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),3,5,7,9,13,15-heptaene-16-carboxylate.
| Compound Name | methyl 12,12-dimethyl-17-oxo-18-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),3,5,7,9,13,15-heptaene-16-carboxylate |
|---|---|
| PubChem CID | 147061913 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 12,12-dimethyl-17-oxo-18-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),3,5,7,9,13,15-heptaene-16-carboxylate |
| SMILES | COC(=O)C1=CC2=C3N(CCC2OC1=O)c1ccc2ccccc2c1C3(C)C |
| InChI | InChI=1S/C23H21NO4/c1-23(2)19-14-7-5-4-6-13(14)8-9-17(19)24-11-10-18-15(20(23)24)12-16(21(25)27-3)22(26)28-18/h4-9,12,18H,10-11H2,1-3H3 |
| InChIKey | BDIKVEFATOVGOT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|