C21H16F4N2O2 — CID 147062979
(3R)-4-(5-fluoroindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one (PubChem CID 147062979) has the molecular formula C21H16F4N2O2 and a molecular weight of 404.36 g/mol. Its IUPAC name is (3R)-4-(5-fluoroindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | (3R)-4-(5-fluoroindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 147062979 |
| Molecular Formula | C21H16F4N2O2 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (3R)-4-(5-fluoroindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@](C)(O)Cn2ccc3cc(F)ccc32)cc1C(F)(F)F |
| InChI | InChI=1S/C21H16F4N2O2/c1-20(29,12-27-8-7-14-11-15(22)4-6-18(14)27)19(28)10-13-3-5-17(26-2)16(9-13)21(23,24)25/h3-9,11,29H,10,12H2,1H3/t20-/m1/s1 |
| InChIKey | BDNNPEOLQDIQFR-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|