C20H13F7N4O2 — CID 14706495
[5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 14706495) has the molecular formula C20H13F7N4O2 and a molecular weight of 474.34 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 14706495 |
| Molecular Formula | C20H13F7N4O2 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | CC1N(C(=O)c2c(F)c(F)c(F)c(F)c2F)COC1(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H13F7N4O2/c1-9-20(5-30-7-28-6-29-30,11-3-2-10(21)4-12(11)22)33-8-31(9)19(32)13-14(23)16(25)18(27)17(26)15(13)24/h2-4,6-7,9H,5,8H2,1H3 |
| InChIKey | FPHBGKBOVVLQED-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|