C12H16F3NO2 — CID 147067410
(3S)-3-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]morpholine (PubChem CID 147067410) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is (3S)-3-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]morpholine.
| Compound Name | (3S)-3-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]morpholine |
|---|---|
| PubChem CID | 147067410 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (3S)-3-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]morpholine |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)[C@H]1COCCN1 |
| InChI | InChI=1S/C12H16F3NO2/c1-3-10(18-12(13,14)15)5-4-9(2)11-8-17-7-6-16-11/h3-5,11,16H,2,6-8H2,1H3/b5-4-,10-3+/t11-/m1/s1 |
| InChIKey | BEJNKCZIJBYAGA-FGSAAZCDSA-N |
| XLogP | 2.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|