About N'-(N'-iodocarbamimidoyl)methanimidamide
N'-(N'-iodocarbamimidoyl)methanimidamide (PubChem CID 147068103) has the molecular formula C2H5IN4
and a molecular weight of 211.99 g/mol. Its IUPAC name is N'-(N'-iodocarbamimidoyl)methanimidamide.
Molecular Properties
| Compound Name | N'-(N'-iodocarbamimidoyl)methanimidamide |
| PubChem CID | 147068103 |
| Molecular Formula | C2H5IN4 |
| Molecular Weight | 211.99 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | N'-(N'-iodocarbamimidoyl)methanimidamide |
| SMILES | NC=NC(N)=NI |
| InChI | InChI=1S/C2H5IN4/c3-7-2(5)6-1-4/h1H,(H4,4,5,6,7) |
| InChIKey | BEMXBIZSDZEJTM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.99 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-(N'-iodocarbamimidoyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(N'-iodocarbamimidoyl)methanimidamide?
The IUPAC name of N'-(N'-iodocarbamimidoyl)methanimidamide (CID 147068103) is N'-(N'-iodocarbamimidoyl)methanimidamide.
What is the SMILES notation for N'-(N'-iodocarbamimidoyl)methanimidamide?
The canonical SMILES for N'-(N'-iodocarbamimidoyl)methanimidamide is NC=NC(N)=NI.
What is the InChIKey of N'-(N'-iodocarbamimidoyl)methanimidamide?
The InChIKey is BEMXBIZSDZEJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5IN4/c3-7-2(5)6-1-4/h1H,(H4,4,5,6,7).
What are the key properties of N'-(N'-iodocarbamimidoyl)methanimidamide?
N'-(N'-iodocarbamimidoyl)methanimidamide has a molecular weight of 211.99 g/mol, XLogP of -0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(N'-iodocarbamimidoyl)methanimidamide is sourced from PubChem (CID 147068103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).