About 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 147068755) has the molecular formula C13H20FNO6
and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 147068755 |
| Molecular Formula | C13H20FNO6 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OCCF)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20FNO6/c1-13(2,3)21-12(18)15-8(11(17)19-4)7-9(10(15)16)20-6-5-14/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | BEPZRBIMQQUMBL-DTWKUNHWSA-N |
| XLogP | 1.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate (CID 147068755) is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate is COC(=O)[C@@H]1C[C@@H](OCCF)C(=O)N1C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is BEPZRBIMQQUMBL-DTWKUNHWSA-N. The full InChI is InChI=1S/C13H20FNO6/c1-13(2,3)21-12(18)15-8(11(17)19-4)7-9(10(15)16)20-6-5-14/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate?
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 305.30 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(2-fluoroethoxy)-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 147068755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).