About methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate
methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate (PubChem CID 14706908) has the molecular formula C21H28O4
and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate |
| PubChem CID | 14706908 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate |
| SMILES | COC(=O)[C@H](C)c1c([C@@]2(C)CCCC(C)(C)C2)ccc2c1C(=O)OC2 |
| InChI | InChI=1S/C21H28O4/c1-13(18(22)24-5)16-15(8-7-14-11-25-19(23)17(14)16)21(4)10-6-9-20(2,3)12-21/h7-8,13H,6,9-12H2,1-5H3/t13-,21+/m1/s1 |
| InChIKey | YWRLUOURIMRHED-ASSNKEHSSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate?
The IUPAC name of methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate (CID 14706908) is methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate.
What is the SMILES notation for methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate?
The canonical SMILES for methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate is COC(=O)[C@H](C)c1c([C@@]2(C)CCCC(C)(C)C2)ccc2c1C(=O)OC2.
What is the InChIKey of methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate?
The InChIKey is YWRLUOURIMRHED-ASSNKEHSSA-N. The full InChI is InChI=1S/C21H28O4/c1-13(18(22)24-5)16-15(8-7-14-11-25-19(23)17(14)16)21(4)10-6-9-20(2,3)12-21/h7-8,13H,6,9-12H2,1-5H3/t13-,21+/m1/s1.
What are the key properties of methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate?
methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate has a molecular weight of 344.45 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[3-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-1H-2-benzofuran-4-yl]propanoate is sourced from PubChem (CID 14706908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).