About [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate
[6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate (PubChem CID 147073827) has the molecular formula C15H11Cl2N3O2
and a molecular weight of 336.18 g/mol. Its IUPAC name is [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate.
Molecular Properties
| Compound Name | [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate |
| PubChem CID | 147073827 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate |
| SMILES | O=COc1c(NCc2cc(Cl)cc(Cl)c2)ccc2nccn12 |
| InChI | InChI=1S/C15H11Cl2N3O2/c16-11-5-10(6-12(17)7-11)8-19-13-1-2-14-18-3-4-20(14)15(13)22-9-21/h1-7,9,19H,8H2 |
| InChIKey | BFOKVWIGPDUQOW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate?
The IUPAC name of [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate (CID 147073827) is [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate.
What is the SMILES notation for [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate?
The canonical SMILES for [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate is O=COc1c(NCc2cc(Cl)cc(Cl)c2)ccc2nccn12.
What is the InChIKey of [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate?
The InChIKey is BFOKVWIGPDUQOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O2/c16-11-5-10(6-12(17)7-11)8-19-13-1-2-14-18-3-4-20(14)15(13)22-9-21/h1-7,9,19H,8H2.
What are the key properties of [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate?
[6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate has a molecular weight of 336.18 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(3,5-dichlorophenyl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate is sourced from PubChem (CID 147073827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).