C21H22BrN5O2 — CID 147073865
1-(6-bromo-2-pyridinyl)-2-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]ethanone (PubChem CID 147073865) has the molecular formula C21H22BrN5O2 and a molecular weight of 456.34 g/mol. Its IUPAC name is 1-(6-bromo-2-pyridinyl)-2-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]ethanone.
| Compound Name | 1-(6-bromo-2-pyridinyl)-2-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]ethanone |
|---|---|
| PubChem CID | 147073865 |
| Molecular Formula | C21H22BrN5O2 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-(6-bromo-2-pyridinyl)-2-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]ethanone |
| SMILES | CN1CCN(C(=O)Cn2cc3cc(CC(=O)c4cccc(Br)n4)ccc3n2)CC1 |
| InChI | InChI=1S/C21H22BrN5O2/c1-25-7-9-26(10-8-25)21(29)14-27-13-16-11-15(5-6-17(16)24-27)12-19(28)18-3-2-4-20(22)23-18/h2-6,11,13H,7-10,12,14H2,1H3 |
| InChIKey | BFORJKYHTFBJAW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|