C19H12N2O2 — CID 147074820
4-[2-(4,7-dimethyl-1,3-dioxoisoindol-2-yl)ethynyl]benzonitrile (PubChem CID 147074820) has the molecular formula C19H12N2O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[2-(4,7-dimethyl-1,3-dioxoisoindol-2-yl)ethynyl]benzonitrile.
| Compound Name | 4-[2-(4,7-dimethyl-1,3-dioxoisoindol-2-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 147074820 |
| Molecular Formula | C19H12N2O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[2-(4,7-dimethyl-1,3-dioxoisoindol-2-yl)ethynyl]benzonitrile |
| SMILES | Cc1ccc(C)c2c1C(=O)N(C#Cc1ccc(C#N)cc1)C2=O |
| InChI | InChI=1S/C19H12N2O2/c1-12-3-4-13(2)17-16(12)18(22)21(19(17)23)10-9-14-5-7-15(11-20)8-6-14/h3-8H,1-2H3 |
| InChIKey | BFTLGWQUQSRKCG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|