C15H24O — CID 14707673
(2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraen-1-ol (PubChem CID 14707673) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraen-1-ol.
| Compound Name | (2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraen-1-ol |
|---|---|
| PubChem CID | 14707673 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraen-1-ol |
| SMILES | CC(C)=CCC/C(C)=C\C=C\C(C)=C\CO |
| InChI | InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h6-7,9-11,16H,5,8,12H2,1-4H3/b10-6+,14-9-,15-11+ |
| InChIKey | OHADHRSISRNOHA-SFZXIVCKSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|