About 3-methyl-1,2-thiazole-4-carbonitrile
3-methyl-1,2-thiazole-4-carbonitrile (PubChem CID 14707892) has the molecular formula C5H4N2S
and a molecular weight of 124.17 g/mol. Its IUPAC name is 3-methyl-1,2-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-1,2-thiazole-4-carbonitrile |
| PubChem CID | 14707892 |
| Molecular Formula | C5H4N2S |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 3-methyl-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1nscc1C#N |
| InChI | InChI=1S/C5H4N2S/c1-4-5(2-6)3-8-7-4/h3H,1H3 |
| InChIKey | CLQASPKCRDAKSG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2-thiazole-4-carbonitrile?
The IUPAC name of 3-methyl-1,2-thiazole-4-carbonitrile (CID 14707892) is 3-methyl-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 3-methyl-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 3-methyl-1,2-thiazole-4-carbonitrile is Cc1nscc1C#N.
What is the InChIKey of 3-methyl-1,2-thiazole-4-carbonitrile?
The InChIKey is CLQASPKCRDAKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S/c1-4-5(2-6)3-8-7-4/h3H,1H3.
What are the key properties of 3-methyl-1,2-thiazole-4-carbonitrile?
3-methyl-1,2-thiazole-4-carbonitrile has a molecular weight of 124.17 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 14707892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).