About tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate
tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate (PubChem CID 14708122) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate |
| PubChem CID | 14708122 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)CC(O)c1cccnc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-16(2,3)15(22)19-14-11(8-7-9-18-14)12(20)10-13(21)23-17(4,5)6/h7-9,12,20H,10H2,1-6H3,(H,18,19,22) |
| InChIKey | UHECQKUJUMUNPH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The IUPAC name of tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate (CID 14708122) is tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate.
What is the SMILES notation for tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The canonical SMILES for tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate is CC(C)(C)OC(=O)CC(O)c1cccnc1NC(=O)C(C)(C)C.
What is the InChIKey of tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The InChIKey is UHECQKUJUMUNPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-16(2,3)15(22)19-14-11(8-7-9-18-14)12(20)10-13(21)23-17(4,5)6/h7-9,12,20H,10H2,1-6H3,(H,18,19,22).
What are the key properties of tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate has a molecular weight of 322.41 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate is sourced from PubChem (CID 14708122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).