About 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine
4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine (PubChem CID 14708177) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine |
| PubChem CID | 14708177 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine |
| SMILES | COC1CC=C(N2CCOCC2)CO1 |
| InChI | InChI=1S/C10H17NO3/c1-12-10-3-2-9(8-14-10)11-4-6-13-7-5-11/h2,10H,3-8H2,1H3 |
| InChIKey | HHRJEGUFUOMXHC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine?
The IUPAC name of 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine (CID 14708177) is 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine.
What is the SMILES notation for 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine?
The canonical SMILES for 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine is COC1CC=C(N2CCOCC2)CO1.
What is the InChIKey of 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine?
The InChIKey is HHRJEGUFUOMXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-12-10-3-2-9(8-14-10)11-4-6-13-7-5-11/h2,10H,3-8H2,1H3.
What are the key properties of 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine?
4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine has a molecular weight of 199.25 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxy-3,6-dihydro-2H-pyran-5-yl)morpholine is sourced from PubChem (CID 14708177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).