C33H37F3N8O — CID 147084158
6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(1,3,3-trifluorocyclobutyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 147084158) has the molecular formula C33H37F3N8O and a molecular weight of 618.71 g/mol. Its IUPAC name is 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(1,3,3-trifluorocyclobutyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(1,3,3-trifluorocyclobutyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 147084158 |
| Molecular Formula | C33H37F3N8O |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enyl-1-[6-(1,3,3-trifluorocyclobutyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CCN(C)CC5)CC4)cc3)nc2n1-c1cccc(C2(F)CC(F)(F)C2)n1 |
| InChI | InChI=1S/C33H37F3N8O/c1-3-15-43-29(45)25-20-37-30(40-28(25)44(43)27-6-4-5-26(39-27)32(34)21-33(35,36)22-32)38-23-7-9-24(10-8-23)42-18-13-31(14-19-42)11-16-41(2)17-12-31/h3-10,20H,1,11-19,21-22H2,2H3,(H,37,38,40) |
| InChIKey | BHMWHIBJBPPDED-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|