C12H17N3O — CID 14708555
5,5-diethyl-2-phenyl-1,2,4-triazolidin-3-one (PubChem CID 14708555) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 5,5-diethyl-2-phenyl-1,2,4-triazolidin-3-one.
| Compound Name | 5,5-diethyl-2-phenyl-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 14708555 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5,5-diethyl-2-phenyl-1,2,4-triazolidin-3-one |
| SMILES | CCC1(CC)NC(=O)N(c2ccccc2)N1 |
| InChI | InChI=1S/C12H17N3O/c1-3-12(4-2)13-11(16)15(14-12)10-8-6-5-7-9-10/h5-9,14H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | VKBZLWXNYSFLIE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |