C17H19NO2 — CID 14708673
6-(benzylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol (PubChem CID 14708673) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 6-(benzylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol.
| Compound Name | 6-(benzylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 14708673 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-(benzylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol |
| SMILES | Oc1cc2c(cc1O)CC(NCc1ccccc1)CC2 |
| InChI | InChI=1S/C17H19NO2/c19-16-9-13-6-7-15(8-14(13)10-17(16)20)18-11-12-4-2-1-3-5-12/h1-5,9-10,15,18-20H,6-8,11H2 |
| InChIKey | YOZGWJXSKNAAGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|