C15H11ClF3N5O2 — CID 1470905
4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 1470905) has the molecular formula C15H11ClF3N5O2 and a molecular weight of 385.73 g/mol. Its IUPAC name is 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 1470905 |
| Molecular Formula | C15H11ClF3N5O2 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cccnc2n(CCNc2ncc(C(F)(F)F)cc2Cl)c1=O |
| InChI | InChI=1S/C15H11ClF3N5O2/c16-9-6-8(15(17,18)19)7-22-11(9)20-4-5-24-12-10(2-1-3-21-12)23-13(25)14(24)26/h1-3,6-7H,4-5H2,(H,20,22)(H,23,25) |
| InChIKey | HKXFDXRLJOPDDW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|