About tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate
tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate (PubChem CID 147092186) has the molecular formula C20H32N4O3S
and a molecular weight of 408.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate |
| PubChem CID | 147092186 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NCCNC(=O)OC(C)(C)C)sc1NC1CCCCC1 |
| InChI | InChI=1S/C20H32N4O3S/c1-13(21)15-12-16(28-18(15)24-14-8-6-5-7-9-14)17(25)22-10-11-23-19(26)27-20(2,3)4/h12,14,21,24H,5-11H2,1-4H3,(H,22,25)(H,23,26)/b21-13+ |
| InChIKey | BJAPOWAXIRNVEV-FYJGNVAPSA-N |
| XLogP | 4.13 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate (CID 147092186) is tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate is [H]/N=C(\C)c1cc(C(=O)NCCNC(=O)OC(C)(C)C)sc1NC1CCCCC1.
What is the InChIKey of tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate?
The InChIKey is BJAPOWAXIRNVEV-FYJGNVAPSA-N. The full InChI is InChI=1S/C20H32N4O3S/c1-13(21)15-12-16(28-18(15)24-14-8-6-5-7-9-14)17(25)22-10-11-23-19(26)27-20(2,3)4/h12,14,21,24H,5-11H2,1-4H3,(H,22,25)(H,23,26)/b21-13+.
What are the key properties of tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate?
tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate has a molecular weight of 408.57 g/mol, XLogP of 4.13, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[[5-(cyclohexylamino)-4-ethanimidoylthiophene-2-carbonyl]amino]ethyl]carbamate is sourced from PubChem (CID 147092186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).