About (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium
(1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium (PubChem CID 147093121) has the molecular formula C17H27NOY-2
and a molecular weight of 350.31 g/mol. Its IUPAC name is (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium.
Molecular Properties
| Compound Name | (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium |
| PubChem CID | 147093121 |
| Molecular Formula | C17H27NOY-2 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium |
| SMILES | CC(C)(C)N1CCC(CO)(c2[c-]cccc2)CC1.[CH3-].[Y] |
| InChI | InChI=1S/C16H24NO.CH3.Y/c1-15(2,3)17-11-9-16(13-18,10-12-17)14-7-5-4-6-8-14;;/h4-7,18H,9-13H2,1-3H3;1H3;/q2*-1; |
| InChIKey | ZWDMNTYZSVSCDI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium?
The IUPAC name of (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium (CID 147093121) is (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium.
What is the SMILES notation for (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium?
The canonical SMILES for (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium is CC(C)(C)N1CCC(CO)(c2[c-]cccc2)CC1.[CH3-].[Y].
What is the InChIKey of (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium?
The InChIKey is ZWDMNTYZSVSCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24NO.CH3.Y/c1-15(2,3)17-11-9-16(13-18,10-12-17)14-7-5-4-6-8-14;;/h4-7,18H,9-13H2,1-3H3;1H3;/q2*-1;.
What are the key properties of (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium?
(1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium has a molecular weight of 350.31 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-4-phenylpiperidin-4-yl)methanol;carbanide;yttrium is sourced from PubChem (CID 147093121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).