C12H12N4OS — CID 14709691
14,14-dimethyl-10-oxa-13-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 14709691) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 14,14-dimethyl-10-oxa-13-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 14,14-dimethyl-10-oxa-13-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 14709691 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 14,14-dimethyl-10-oxa-13-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC1(C)Cc2c(oc3ncn4ncnc4c23)CS1 |
| InChI | InChI=1S/C12H12N4OS/c1-12(2)3-7-8(4-18-12)17-11-9(7)10-13-5-15-16(10)6-14-11/h5-6H,3-4H2,1-2H3 |
| InChIKey | WXBARJKEEDYEFO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |