About 2-butyl-4,5-diphenyl-1H-imidazole
2-butyl-4,5-diphenyl-1H-imidazole (PubChem CID 14710025) has the molecular formula C19H20N2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-butyl-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-butyl-4,5-diphenyl-1H-imidazole |
| PubChem CID | 14710025 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-butyl-4,5-diphenyl-1H-imidazole |
| SMILES | CCCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C19H20N2/c1-2-3-14-17-20-18(15-10-6-4-7-11-15)19(21-17)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3,(H,20,21) |
| InChIKey | AVTLTWGTYRLMEQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-butyl-4,5-diphenyl-1H-imidazole (CID 14710025) is 2-butyl-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-butyl-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-butyl-4,5-diphenyl-1H-imidazole is CCCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-butyl-4,5-diphenyl-1H-imidazole?
The InChIKey is AVTLTWGTYRLMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2/c1-2-3-14-17-20-18(15-10-6-4-7-11-15)19(21-17)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3,(H,20,21).
What are the key properties of 2-butyl-4,5-diphenyl-1H-imidazole?
2-butyl-4,5-diphenyl-1H-imidazole has a molecular weight of 276.38 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 14710025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).