About (2R)-4,4,4-trifluoro-2-methylbutanimidamide
(2R)-4,4,4-trifluoro-2-methylbutanimidamide (PubChem CID 147100872) has the molecular formula C5H9F3N2
and a molecular weight of 154.13 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-methylbutanimidamide.
Molecular Properties
| Compound Name | (2R)-4,4,4-trifluoro-2-methylbutanimidamide |
| PubChem CID | 147100872 |
| Molecular Formula | C5H9F3N2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-methylbutanimidamide |
| SMILES | [H]/N=C(\N)[C@H](C)CC(F)(F)F |
| InChI | InChI=1S/C5H9F3N2/c1-3(4(9)10)2-5(6,7)8/h3H,2H2,1H3,(H3,9,10)/t3-/m1/s1 |
| InChIKey | BKQAZRJIKZIGTB-GSVOUGTGSA-N |
| XLogP | 1.51 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4,4,4-trifluoro-2-methylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4,4-trifluoro-2-methylbutanimidamide?
The IUPAC name of (2R)-4,4,4-trifluoro-2-methylbutanimidamide (CID 147100872) is (2R)-4,4,4-trifluoro-2-methylbutanimidamide.
What is the SMILES notation for (2R)-4,4,4-trifluoro-2-methylbutanimidamide?
The canonical SMILES for (2R)-4,4,4-trifluoro-2-methylbutanimidamide is [H]/N=C(\N)[C@H](C)CC(F)(F)F.
What is the InChIKey of (2R)-4,4,4-trifluoro-2-methylbutanimidamide?
The InChIKey is BKQAZRJIKZIGTB-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H9F3N2/c1-3(4(9)10)2-5(6,7)8/h3H,2H2,1H3,(H3,9,10)/t3-/m1/s1.
What are the key properties of (2R)-4,4,4-trifluoro-2-methylbutanimidamide?
(2R)-4,4,4-trifluoro-2-methylbutanimidamide has a molecular weight of 154.13 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4,4-trifluoro-2-methylbutanimidamide is sourced from PubChem (CID 147100872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).