About 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine
4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine (PubChem CID 14710482) has the molecular formula C12H24N2O2S3
and a molecular weight of 324.54 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine |
| PubChem CID | 14710482 |
| Molecular Formula | C12H24N2O2S3 |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(SSSN2CC(C)OC(C)C2)CC(C)O1 |
| InChI | InChI=1S/C12H24N2O2S3/c1-9-5-13(6-10(2)15-9)17-19-18-14-7-11(3)16-12(4)8-14/h9-12H,5-8H2,1-4H3 |
| InChIKey | FNIYWTPQOMDKRZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine (CID 14710482) is 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine is CC1CN(SSSN2CC(C)OC(C)C2)CC(C)O1.
What is the InChIKey of 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine?
The InChIKey is FNIYWTPQOMDKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2S3/c1-9-5-13(6-10(2)15-9)17-19-18-14-7-11(3)16-12(4)8-14/h9-12H,5-8H2,1-4H3.
What are the key properties of 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine?
4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine has a molecular weight of 324.54 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylmorpholin-4-yl)trisulfanyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 14710482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).