About 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride
3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride (PubChem CID 14711033) has the molecular formula C12H11ClF3NO3
and a molecular weight of 309.67 g/mol. Its IUPAC name is 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride.
Molecular Properties
| Compound Name | 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride |
| PubChem CID | 14711033 |
| Molecular Formula | C12H11ClF3NO3 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride |
| SMILES | COc1ccc(N(CCC(=O)Cl)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11ClF3NO3/c1-20-9-4-2-8(3-5-9)17(7-6-10(13)18)11(19)12(14,15)16/h2-5H,6-7H2,1H3 |
| InChIKey | UZIBYAKOKNMYRL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride?
The IUPAC name of 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride (CID 14711033) is 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride.
What is the SMILES notation for 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride?
The canonical SMILES for 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride is COc1ccc(N(CCC(=O)Cl)C(=O)C(F)(F)F)cc1.
What is the InChIKey of 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride?
The InChIKey is UZIBYAKOKNMYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF3NO3/c1-20-9-4-2-8(3-5-9)17(7-6-10(13)18)11(19)12(14,15)16/h2-5H,6-7H2,1H3.
What are the key properties of 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride?
3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride has a molecular weight of 309.67 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)propanoyl chloride is sourced from PubChem (CID 14711033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).