C22H31FN2O5S — CID 147111451
1-[(E)-5-[2-[4-fluoro-3-(2-methylpropoxy)phenyl]-2-methylpropyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione (PubChem CID 147111451) has the molecular formula C22H31FN2O5S and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-[(E)-5-[2-[4-fluoro-3-(2-methylpropoxy)phenyl]-2-methylpropyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-5-[2-[4-fluoro-3-(2-methylpropoxy)phenyl]-2-methylpropyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 147111451 |
| Molecular Formula | C22H31FN2O5S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[(E)-5-[2-[4-fluoro-3-(2-methylpropoxy)phenyl]-2-methylpropyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione |
| SMILES | CC(C)COc1cc(C(C)(C)CS(=O)(=O)CC/C=C/CN2CC(=O)NC2=O)ccc1F |
| InChI | InChI=1S/C22H31FN2O5S/c1-16(2)14-30-19-12-17(8-9-18(19)23)22(3,4)15-31(28,29)11-7-5-6-10-25-13-20(26)24-21(25)27/h5-6,8-9,12,16H,7,10-11,13-15H2,1-4H3,(H,24,26,27)/b6-5+ |
| InChIKey | BMOXBOPPBTTWCD-AATRIKPKSA-N |
| XLogP | 3.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|