About N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide
N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 147114660) has the molecular formula C23H30N4O
and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide.
Molecular Properties
| Compound Name | N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide |
| PubChem CID | 147114660 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | N/C(=N\Cc1ccccc1)N(CCN1CCCCC1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H30N4O/c24-23(25-19-21-12-6-2-7-13-21)27(17-16-26-14-8-3-9-15-26)22(28)18-20-10-4-1-5-11-20/h1-2,4-7,10-13H,3,8-9,14-19H2,(H2,24,25) |
| InChIKey | BNEGXSGSZRFOBV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide?
The IUPAC name of N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide (CID 147114660) is N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide.
What is the SMILES notation for N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide?
The canonical SMILES for N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide is N/C(=N\Cc1ccccc1)N(CCN1CCCCC1)C(=O)Cc1ccccc1.
What is the InChIKey of N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide?
The InChIKey is BNEGXSGSZRFOBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4O/c24-23(25-19-21-12-6-2-7-13-21)27(17-16-26-14-8-3-9-15-26)22(28)18-20-10-4-1-5-11-20/h1-2,4-7,10-13H,3,8-9,14-19H2,(H2,24,25).
What are the key properties of N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide?
N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide has a molecular weight of 378.52 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-benzylcarbamimidoyl)-2-phenyl-N-(2-piperidin-1-ylethyl)acetamide is sourced from PubChem (CID 147114660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).