C13H20OS — CID 14711850
2-methyl-4-(1-propylsulfanylpropan-2-yl)phenol (PubChem CID 14711850) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-methyl-4-(1-propylsulfanylpropan-2-yl)phenol.
| Compound Name | 2-methyl-4-(1-propylsulfanylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 14711850 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-methyl-4-(1-propylsulfanylpropan-2-yl)phenol |
| SMILES | CCCSCC(C)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C13H20OS/c1-4-7-15-9-11(3)12-5-6-13(14)10(2)8-12/h5-6,8,11,14H,4,7,9H2,1-3H3 |
| InChIKey | YKTHKSAWLJSAFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|