C20H12F4I4O7S — CID 147118933
4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 147118933) has the molecular formula C20H12F4I4O7S and a molecular weight of 979.98 g/mol. Its IUPAC name is 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 147118933 |
| Molecular Formula | C20H12F4I4O7S |
| Molecular Weight | 979.98 g/mol |
| Exact Mass | 979.64 |
| IUPAC Name | 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(I)c(I)c(I)c(I)c1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H12F4I4O7S/c21-9-11(23)18(36(31,32)33)12(24)10(22)17(9)35-20(30)8-7(13(25)15(27)16(28)14(8)26)19(29)34-6-4-2-1-3-5-6/h6H,1-5H2,(H,31,32,33) |
| InChIKey | BNYVKFMXPMCNFA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.98 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|