About dodec-1-en-4-amine
dodec-1-en-4-amine (PubChem CID 14711916) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is dodec-1-en-4-amine.
Molecular Properties
| Compound Name | dodec-1-en-4-amine |
| PubChem CID | 14711916 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | dodec-1-en-4-amine |
| SMILES | C=CCC(N)CCCCCCCC |
| InChI | InChI=1S/C12H25N/c1-3-5-6-7-8-9-11-12(13)10-4-2/h4,12H,2-3,5-11,13H2,1H3 |
| InChIKey | XCIGUOCYKMJLQW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodec-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-1-en-4-amine?
The IUPAC name of dodec-1-en-4-amine (CID 14711916) is dodec-1-en-4-amine.
What is the SMILES notation for dodec-1-en-4-amine?
The canonical SMILES for dodec-1-en-4-amine is C=CCC(N)CCCCCCCC.
What is the InChIKey of dodec-1-en-4-amine?
The InChIKey is XCIGUOCYKMJLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-3-5-6-7-8-9-11-12(13)10-4-2/h4,12H,2-3,5-11,13H2,1H3.
What are the key properties of dodec-1-en-4-amine?
dodec-1-en-4-amine has a molecular weight of 183.34 g/mol, XLogP of 3.64, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-1-en-4-amine is sourced from PubChem (CID 14711916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).