C29H47N3O8 — CID 147120393
N-[3-[(2S,3R)-4-(5-oxohept-6-enoxy)-2,3-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide (PubChem CID 147120393) has the molecular formula C29H47N3O8 and a molecular weight of 565.71 g/mol. Its IUPAC name is N-[3-[(2S,3R)-4-(5-oxohept-6-enoxy)-2,3-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide.
| Compound Name | N-[3-[(2S,3R)-4-(5-oxohept-6-enoxy)-2,3-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 147120393 |
| Molecular Formula | C29H47N3O8 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | N-[3-[(2S,3R)-4-(5-oxohept-6-enoxy)-2,3-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)CCCCOC[C@@H](OCCCNC(=O)C=C)[C@H](COCCCNC(=O)C=C)OCCCNC(=O)C=C |
| InChI | InChI=1S/C29H47N3O8/c1-5-24(33)14-9-10-18-37-22-25(39-20-12-16-31-28(35)7-3)26(40-21-13-17-32-29(36)8-4)23-38-19-11-15-30-27(34)6-2/h5-8,25-26H,1-4,9-23H2,(H,30,34)(H,31,35)(H,32,36)/t25-,26+/m1/s1 |
| InChIKey | BOGBCNIYGILLRN-FTJBHMTQSA-N |
| XLogP | 1.79 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|