C45H30N3O2P — CID 147120675
4-[9-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-2,6-dipyridin-2-ylpyridine (PubChem CID 147120675) has the molecular formula C45H30N3O2P and a molecular weight of 675.73 g/mol. Its IUPAC name is 4-[9-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[9-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 147120675 |
| Molecular Formula | C45H30N3O2P |
| Molecular Weight | 675.73 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 4-[9-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-2,6-dipyridin-2-ylpyridine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2cccc3oc4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4c23)cc1 |
| InChI | InChI=1S/C45H30N3O2P/c49-51(34-12-3-1-4-13-34,35-14-5-2-6-15-35)36-23-20-31(21-24-36)37-16-11-19-44-45(37)38-28-32(22-25-43(38)50-44)33-29-41(39-17-7-9-26-46-39)48-42(30-33)40-18-8-10-27-47-40/h1-30H |
| InChIKey | BOHHRZPFERDXJO-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.73 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|