C22H26N2O5S2 — CID 147123611
8-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonine-6,7-dione (PubChem CID 147123611) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 8-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonine-6,7-dione.
| Compound Name | 8-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonine-6,7-dione |
|---|---|
| PubChem CID | 147123611 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 8-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-[1,3]thiazolo[5,4-c]azonine-6,7-dione |
| SMILES | CC(C)C(CS(=O)(=O)c1ccccc1)C(=O)CC1CCc2ncsc2CNC(=O)C1=O |
| InChI | InChI=1S/C22H26N2O5S2/c1-14(2)17(12-31(28,29)16-6-4-3-5-7-16)19(25)10-15-8-9-18-20(30-13-24-18)11-23-22(27)21(15)26/h3-7,13-15,17H,8-12H2,1-2H3,(H,23,27) |
| InChIKey | BOVTYZAWUUKHBB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|