C32H37F4N5O5 — CID 147123887
(2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate (PubChem CID 147123887) has the molecular formula C32H37F4N5O5 and a molecular weight of 647.67 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 147123887 |
| Molecular Formula | C32H37F4N5O5 |
| Molecular Weight | 647.67 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)CCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H37F4N5O5/c1-2-3-10-24-40-29-30(20-8-4-5-9-23(20)39-32(29)37)41(24)14-7-6-13-38-25(42)11-15-44-17-18-45-16-12-26(43)46-31-27(35)21(33)19-22(34)28(31)36/h4-5,8-9,19H,2-3,6-7,10-18H2,1H3,(H2,37,39)(H,38,42) |
| InChIKey | BOWZAIHMCNCILA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|