About 1H-pteridine-2-thione
1H-pteridine-2-thione (PubChem CID 14712407) has the molecular formula C6H4N4S
and a molecular weight of 164.19 g/mol. Its IUPAC name is 1H-pteridine-2-thione.
Molecular Properties
| Compound Name | 1H-pteridine-2-thione |
| PubChem CID | 14712407 |
| Molecular Formula | C6H4N4S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 1H-pteridine-2-thione |
| SMILES | S=c1ncc2nccnc2[nH]1 |
| InChI | InChI=1S/C6H4N4S/c11-6-9-3-4-5(10-6)8-2-1-7-4/h1-3H,(H,8,9,10,11) |
| InChIKey | DAAQPMSPBHQGQA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pteridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pteridine-2-thione?
The IUPAC name of 1H-pteridine-2-thione (CID 14712407) is 1H-pteridine-2-thione.
What is the SMILES notation for 1H-pteridine-2-thione?
The canonical SMILES for 1H-pteridine-2-thione is S=c1ncc2nccnc2[nH]1.
What is the InChIKey of 1H-pteridine-2-thione?
The InChIKey is DAAQPMSPBHQGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4S/c11-6-9-3-4-5(10-6)8-2-1-7-4/h1-3H,(H,8,9,10,11).
What are the key properties of 1H-pteridine-2-thione?
1H-pteridine-2-thione has a molecular weight of 164.19 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pteridine-2-thione is sourced from PubChem (CID 14712407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).