C21H25F2N3O3 — CID 147125307
7-[(3aS,7aS)-3a-amino-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-3-methylquinolin-4-one (PubChem CID 147125307) has the molecular formula C21H25F2N3O3 and a molecular weight of 405.45 g/mol. Its IUPAC name is 7-[(3aS,7aS)-3a-amino-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-3-methylquinolin-4-one.
| Compound Name | 7-[(3aS,7aS)-3a-amino-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-3-methylquinolin-4-one |
|---|---|
| PubChem CID | 147125307 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 7-[(3aS,7aS)-3a-amino-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-3-methylquinolin-4-one |
| SMILES | COc1c(N2C[C@@H]3CCOC[C@@]3(N)C2)c(F)cc2c(=O)c(C)cn([C@@H]3C[C@@H]3F)c12 |
| InChI | InChI=1S/C21H25F2N3O3/c1-11-7-26(16-6-14(16)22)17-13(19(11)27)5-15(23)18(20(17)28-2)25-8-12-3-4-29-10-21(12,24)9-25/h5,7,12,14,16H,3-4,6,8-10,24H2,1-2H3/t12-,14-,16+,21-/m0/s1 |
| InChIKey | BPDUHAKODVZHCO-OQHWTSBZSA-N |
| XLogP | 2.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |