About 7-phenyl-6H-1,6-naphthyridin-5-one
7-phenyl-6H-1,6-naphthyridin-5-one (PubChem CID 14713041) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 7-phenyl-6H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 7-phenyl-6H-1,6-naphthyridin-5-one |
| PubChem CID | 14713041 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 7-phenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]c(-c2ccccc2)cc2ncccc12 |
| InChI | InChI=1S/C14H10N2O/c17-14-11-7-4-8-15-13(11)9-12(16-14)10-5-2-1-3-6-10/h1-9H,(H,16,17) |
| InChIKey | QMFVMTQQOFNDGX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-phenyl-6H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-6H-1,6-naphthyridin-5-one?
The IUPAC name of 7-phenyl-6H-1,6-naphthyridin-5-one (CID 14713041) is 7-phenyl-6H-1,6-naphthyridin-5-one.
What is the SMILES notation for 7-phenyl-6H-1,6-naphthyridin-5-one?
The canonical SMILES for 7-phenyl-6H-1,6-naphthyridin-5-one is O=c1[nH]c(-c2ccccc2)cc2ncccc12.
What is the InChIKey of 7-phenyl-6H-1,6-naphthyridin-5-one?
The InChIKey is QMFVMTQQOFNDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c17-14-11-7-4-8-15-13(11)9-12(16-14)10-5-2-1-3-6-10/h1-9H,(H,16,17).
What are the key properties of 7-phenyl-6H-1,6-naphthyridin-5-one?
7-phenyl-6H-1,6-naphthyridin-5-one has a molecular weight of 222.25 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-6H-1,6-naphthyridin-5-one is sourced from PubChem (CID 14713041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).