C19H24BrN3O4 — CID 147132032
2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]-2,6-dimethylcyclohexyl]oxyethanol (PubChem CID 147132032) has the molecular formula C19H24BrN3O4 and a molecular weight of 438.32 g/mol. Its IUPAC name is 2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]-2,6-dimethylcyclohexyl]oxyethanol.
| Compound Name | 2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]-2,6-dimethylcyclohexyl]oxyethanol |
|---|---|
| PubChem CID | 147132032 |
| Molecular Formula | C19H24BrN3O4 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]-2,6-dimethylcyclohexyl]oxyethanol |
| SMILES | CC1CC(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CC(C)C1OCCO |
| InChI | InChI=1S/C19H24BrN3O4/c1-11-7-14(8-12(2)19(11)27-6-5-24)22-18-15-9-13(20)3-4-16(15)21-10-17(18)23(25)26/h3-4,9-12,14,19,24H,5-8H2,1-2H3,(H,21,22) |
| InChIKey | BQKGFERBFZCMFR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|