C28H20ClF3N4OS — CID 147133693
1-(2-chloro-6-methylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzotriazol-7-yl]methylideneamino]propane-2-thione (PubChem CID 147133693) has the molecular formula C28H20ClF3N4OS and a molecular weight of 553.01 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzotriazol-7-yl]methylideneamino]propane-2-thione.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzotriazol-7-yl]methylideneamino]propane-2-thione |
|---|---|
| PubChem CID | 147133693 |
| Molecular Formula | C28H20ClF3N4OS |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzotriazol-7-yl]methylideneamino]propane-2-thione |
| SMILES | Cc1cccc(Cl)c1CC(=S)C/N=C/c1ccc2c(ccc3c2nnn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H20ClF3N4OS/c1-17-3-2-4-25(29)24(17)14-22(38)16-33-15-18-5-11-23-19(13-18)6-12-26-27(23)34-35-36(26)20-7-9-21(10-8-20)37-28(30,31)32/h2-13,15H,14,16H2,1H3/b33-15+ |
| InChIKey | BQSRIENDNROGOP-ROPCREHHSA-N |
| XLogP | 7.47 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|