C32H26N2O6S4 — CID 147137187
6,19-bis(2-ethylsulfonylethyl)-5,18-dithia-9,22-diazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),6,11,13,15,17(21),19,24(28),25-undecaene-10,23-dione (PubChem CID 147137187) has the molecular formula C32H26N2O6S4 and a molecular weight of 662.84 g/mol. Its IUPAC name is 6,19-bis(2-ethylsulfonylethyl)-5,18-dithia-9,22-diazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),6,11,13,15,17(21),19,24(28),25-undecaene-10,23-dione.
| Compound Name | 6,19-bis(2-ethylsulfonylethyl)-5,18-dithia-9,22-diazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),6,11,13,15,17(21),19,24(28),25-undecaene-10,23-dione |
|---|---|
| PubChem CID | 147137187 |
| Molecular Formula | C32H26N2O6S4 |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.07 |
| IUPAC Name | 6,19-bis(2-ethylsulfonylethyl)-5,18-dithia-9,22-diazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),6,11,13,15,17(21),19,24(28),25-undecaene-10,23-dione |
| SMILES | CCS(=O)(=O)CCc1cc2c(cc3c4ccc5c(=O)n6c7cc(CCS(=O)(=O)CC)sc7cc6c6ccc(c(=O)n23)c4c56)s1 |
| InChI | InChI=1S/C32H26N2O6S4/c1-3-43(37,38)11-9-17-13-25-27(41-17)15-23-19-5-8-22-30-20(6-7-21(29(19)30)31(35)33(23)25)24-16-28-26(34(24)32(22)36)14-18(42-28)10-12-44(39,40)4-2/h5-8,13-16H,3-4,9-12H2,1-2H3 |
| InChIKey | BRJYWZOYEVDBNC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 111.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|