C18H32N2O3 — CID 147146003
tert-butyl (3S,4R)-3-(tert-butylcarbamoyl)-3-methyl-4-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 147146003) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(tert-butylcarbamoyl)-3-methyl-4-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(tert-butylcarbamoyl)-3-methyl-4-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 147146003 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl (3S,4R)-3-(tert-butylcarbamoyl)-3-methyl-4-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@H]1CN(C(=O)OC(C)(C)C)C[C@@]1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H32N2O3/c1-9-10-13-11-20(15(22)23-17(5,6)7)12-18(13,8)14(21)19-16(2,3)4/h9,13H,1,10-12H2,2-8H3,(H,19,21)/t13-,18+/m0/s1 |
| InChIKey | BTBHERGLMQGBKS-SCLBCKFNSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|