C23H26FN7O — CID 147146987
N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(5-methyl-1-prop-2-enylimidazol-2-yl)ethylamino]ethyl]-[1,3]oxazolo[4,5-c]pyridin-4-amine (PubChem CID 147146987) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(5-methyl-1-prop-2-enylimidazol-2-yl)ethylamino]ethyl]-[1,3]oxazolo[4,5-c]pyridin-4-amine.
| Compound Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(5-methyl-1-prop-2-enylimidazol-2-yl)ethylamino]ethyl]-[1,3]oxazolo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 147146987 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(5-methyl-1-prop-2-enylimidazol-2-yl)ethylamino]ethyl]-[1,3]oxazolo[4,5-c]pyridin-4-amine |
| SMILES | C=CCn1c(C)cnc1CCNCCc1nc2c(NCc3ncccc3F)nccc2o1 |
| InChI | InChI=1S/C23H26FN7O/c1-3-13-31-16(2)14-28-20(31)7-10-25-11-8-21-30-22-19(32-21)6-12-27-23(22)29-15-18-17(24)5-4-9-26-18/h3-6,9,12,14,25H,1,7-8,10-11,13,15H2,2H3,(H,27,29) |
| InChIKey | BTFXBHBLTRMLDY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|