C18H22F3N3O — CID 147148080
3-amino-4,4-difluoro-N-(7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl)-2-(methyliminomethyl)but-2-enamide (PubChem CID 147148080) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-amino-4,4-difluoro-N-(7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl)-2-(methyliminomethyl)but-2-enamide.
| Compound Name | 3-amino-4,4-difluoro-N-(7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl)-2-(methyliminomethyl)but-2-enamide |
|---|---|
| PubChem CID | 147148080 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-amino-4,4-difluoro-N-(7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl)-2-(methyliminomethyl)but-2-enamide |
| SMILES | C/N=C/C(C(=O)Nc1ccc(F)c2c1C(C)CC2(C)C)=C(N)C(F)F |
| InChI | InChI=1S/C18H22F3N3O/c1-9-7-18(2,3)14-11(19)5-6-12(13(9)14)24-17(25)10(8-23-4)15(22)16(20)21/h5-6,8-9,16H,7,22H2,1-4H3,(H,24,25)/b15-10?,23-8+ |
| InChIKey | KCODKRJKWZJSKL-ULRNKKCYSA-N |
| XLogP | 3.73 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|