C32H33ClFN5O3 — CID 147148096
1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one (PubChem CID 147148096) has the molecular formula C32H33ClFN5O3 and a molecular weight of 590.10 g/mol. Its IUPAC name is 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one.
| Compound Name | 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one |
|---|---|
| PubChem CID | 147148096 |
| Molecular Formula | C32H33ClFN5O3 |
| Molecular Weight | 590.10 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1CC(=O)C(F)=CCN1CCCCC1 |
| InChI | InChI=1S/C32H33ClFN5O3/c1-2-41-31-19-28-25(16-22(31)17-29(40)27(34)11-15-39-13-6-3-7-14-39)32(37-21-36-28)38-23-9-10-30(26(33)18-23)42-20-24-8-4-5-12-35-24/h4-5,8-12,16,18-19,21H,2-3,6-7,13-15,17,20H2,1H3,(H,36,37,38) |
| InChIKey | BTLNEYGXKUHKBQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.10 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|