About 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one
1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one (PubChem CID 14715017) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one.
Molecular Properties
| Compound Name | 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| PubChem CID | 14715017 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| SMILES | CC(C)OC1=CC(=O)C12OCCO2 |
| InChI | InChI=1S/C9H12O4/c1-6(2)13-8-5-7(10)9(8)11-3-4-12-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | CFVAMLPWPBKEMR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The IUPAC name of 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one (CID 14715017) is 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one.
What is the SMILES notation for 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The canonical SMILES for 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one is CC(C)OC1=CC(=O)C12OCCO2.
What is the InChIKey of 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The InChIKey is CFVAMLPWPBKEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(2)13-8-5-7(10)9(8)11-3-4-12-9/h5-6H,3-4H2,1-2H3.
What are the key properties of 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one?
1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one has a molecular weight of 184.19 g/mol, XLogP of 0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-one is sourced from PubChem (CID 14715017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).