About 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one
1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (PubChem CID 14715041) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
Molecular Properties
| Compound Name | 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| PubChem CID | 14715041 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| SMILES | CC(C)(C)C1=CC(=O)C12OCCO2 |
| InChI | InChI=1S/C10H14O3/c1-9(2,3)7-6-8(11)10(7)12-4-5-13-10/h6H,4-5H2,1-3H3 |
| InChIKey | FCKYWMWVAJHGJL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The IUPAC name of 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (CID 14715041) is 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
What is the SMILES notation for 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The canonical SMILES for 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one is CC(C)(C)C1=CC(=O)C12OCCO2.
What is the InChIKey of 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The InChIKey is FCKYWMWVAJHGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-9(2,3)7-6-8(11)10(7)12-4-5-13-10/h6H,4-5H2,1-3H3.
What are the key properties of 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one has a molecular weight of 182.22 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one is sourced from PubChem (CID 14715041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).