About 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene
1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene (PubChem CID 147152105) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene.
Molecular Properties
| Compound Name | 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene |
| PubChem CID | 147152105 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene |
| SMILES | C=CCc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C13H18/c1-5-7-13-9-10(3)12(6-2)8-11(13)4/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | BUEPSVIWQHQNKG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene?
The IUPAC name of 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene (CID 147152105) is 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene.
What is the SMILES notation for 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene?
The canonical SMILES for 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene is C=CCc1cc(C)c(CC)cc1C.
What is the InChIKey of 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene?
The InChIKey is BUEPSVIWQHQNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18/c1-5-7-13-9-10(3)12(6-2)8-11(13)4/h5,8-9H,1,6-7H2,2-4H3.
What are the key properties of 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene?
1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene has a molecular weight of 174.29 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,5-dimethyl-4-prop-2-enylbenzene is sourced from PubChem (CID 147152105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).