C19H22N4 — CID 147154425
N-benzylspiro[5,8-dihydropyrido[3,2-d]pyrimidine-7,1'-cyclohexane]-6-imine (PubChem CID 147154425) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-benzylspiro[5,8-dihydropyrido[3,2-d]pyrimidine-7,1'-cyclohexane]-6-imine.
| Compound Name | N-benzylspiro[5,8-dihydropyrido[3,2-d]pyrimidine-7,1'-cyclohexane]-6-imine |
|---|---|
| PubChem CID | 147154425 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-benzylspiro[5,8-dihydropyrido[3,2-d]pyrimidine-7,1'-cyclohexane]-6-imine |
| SMILES | c1ccc(C/N=C2\Nc3cncnc3CC23CCCCC3)cc1 |
| InChI | InChI=1S/C19H22N4/c1-3-7-15(8-4-1)12-21-18-19(9-5-2-6-10-19)11-16-17(23-18)13-20-14-22-16/h1,3-4,7-8,13-14H,2,5-6,9-12H2,(H,21,23) |
| InChIKey | BUPOZMCBICGVGH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|