C26H26N4O — CID 147155826
2-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]-1-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanone (PubChem CID 147155826) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]-1-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanone.
| Compound Name | 2-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]-1-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 147155826 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]-1-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanone |
| SMILES | Cn1cncc1-c1ccc2cnc(CC(=O)c3cccc(CN4CCCC4)c3)cc2c1 |
| InChI | InChI=1S/C26H26N4O/c1-29-18-27-16-25(29)20-7-8-22-15-28-24(13-23(22)12-20)14-26(31)21-6-4-5-19(11-21)17-30-9-2-3-10-30/h4-8,11-13,15-16,18H,2-3,9-10,14,17H2,1H3 |
| InChIKey | BUWNDLGBZOHWPR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |