About trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate
trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate (PubChem CID 14715611) has the molecular formula C16H38O4Si4
and a molecular weight of 406.82 g/mol. Its IUPAC name is trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate.
Molecular Properties
| Compound Name | trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate |
| PubChem CID | 14715611 |
| Molecular Formula | C16H38O4Si4 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate |
| SMILES | C[Si](C)(C)/C=C(/O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H38O4Si4/c1-21(2,3)13-14(18-22(4,5)6)15(19-23(7,8)9)16(17)20-24(10,11)12/h13,15H,1-12H3/b14-13+ |
| InChIKey | JPCGKPYTARHRLX-BUHFOSPRSA-N |
| XLogP | 5.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate?
The IUPAC name of trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate (CID 14715611) is trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate.
What is the SMILES notation for trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate?
The canonical SMILES for trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate is C[Si](C)(C)/C=C(/O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate?
The InChIKey is JPCGKPYTARHRLX-BUHFOSPRSA-N. The full InChI is InChI=1S/C16H38O4Si4/c1-21(2,3)13-14(18-22(4,5)6)15(19-23(7,8)9)16(17)20-24(10,11)12/h13,15H,1-12H3/b14-13+.
What are the key properties of trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate?
trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate has a molecular weight of 406.82 g/mol, XLogP of 5.20, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl (E)-4-trimethylsilyl-2,3-bis(trimethylsilyloxy)but-3-enoate is sourced from PubChem (CID 14715611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).